CAS No: 175202-90-1, Chemical Name: 1-chloro-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one
the physical and chemical property of 175202-90-1, 1-chloro-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one is provided by ChemNet.com
ChemNet > CAS > 175202-90-1 1-chloro-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one
175202-90-1 1-chloro-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one
| Название продукта |
1-chloro-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one |
| Синонимы |
1-chloro-6,6-dimethyl-3-(methylsulfanyl)-6,7-dihydro-2-benzothiophen-4(5H)-one |
| Молекулярная формула |
C11H13ClOS2 |
| Молекулярный вес |
260.8033 |
| InChI |
InChI=1/C11H13ClOS2/c1-11(2)4-6-8(7(13)5-11)10(14-3)15-9(6)12/h4-5H2,1-3H3 |
| Регистрационный номер CAS |
175202-90-1 |
| Молекулярная структура |
![175202-90-1 1-chloro-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one](https://images-a.chemnet.com/suppliers/chembase/319/31909.gif)
|
| Плотность |
1.31g/cm3 |
| Температура плавления |
126℃ |
| Точка кипения |
366.5°C at 760 mmHg |
| Показатель преломления |
1.604 |
| Температура вспышки |
175.5°C |
| Символы опасности |
 Xi:Irritant;
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
